C44H88O8Sn — CID 71441902
[dibutyl(9,10-dihydroxyoctadecanoyloxy)stannyl] 9,10-dihydroxyoctadecanoate (PubChem CID 71441902) has the molecular formula C44H88O8Sn and a molecular weight of 863.89 g/mol. Its IUPAC name is [dibutyl(9,10-dihydroxyoctadecanoyloxy)stannyl] 9,10-dihydroxyoctadecanoate.
| Compound Name | [dibutyl(9,10-dihydroxyoctadecanoyloxy)stannyl] 9,10-dihydroxyoctadecanoate |
|---|---|
| PubChem CID | 71441902 |
| Molecular Formula | C44H88O8Sn |
| Molecular Weight | 863.89 g/mol |
| Exact Mass | 864.55 |
| IUPAC Name | [dibutyl(9,10-dihydroxyoctadecanoyloxy)stannyl] 9,10-dihydroxyoctadecanoate |
| SMILES | CCCCCCCCC(O)C(O)CCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCC(O)C(O)CCCCCCCC |
| InChI | InChI=1S/2C18H36O4.2C4H9.Sn/c2*1-2-3-4-5-7-10-13-16(19)17(20)14-11-8-6-9-12-15-18(21)22;2*1-3-4-2;/h2*16-17,19-20H,2-15H2,1H3,(H,21,22);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | KMDVOIRZPPKBHO-UHFFFAOYSA-L |
| XLogP | 11.52 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.89 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|