C28H54O9S3Sn — CID 139668458
[butyl-bis[[6-methoxy-2-(sulfanylmethyl)hexanoyl]oxy]stannyl] 6-methoxy-2-(sulfanylmethyl)hexanoate (PubChem CID 139668458) has the molecular formula C28H54O9S3Sn and a molecular weight of 749.64 g/mol. Its IUPAC name is [butyl-bis[[6-methoxy-2-(sulfanylmethyl)hexanoyl]oxy]stannyl] 6-methoxy-2-(sulfanylmethyl)hexanoate.
| Compound Name | [butyl-bis[[6-methoxy-2-(sulfanylmethyl)hexanoyl]oxy]stannyl] 6-methoxy-2-(sulfanylmethyl)hexanoate |
|---|---|
| PubChem CID | 139668458 |
| Molecular Formula | C28H54O9S3Sn |
| Molecular Weight | 749.64 g/mol |
| Exact Mass | 750.20 |
| IUPAC Name | [butyl-bis[[6-methoxy-2-(sulfanylmethyl)hexanoyl]oxy]stannyl] 6-methoxy-2-(sulfanylmethyl)hexanoate |
| SMILES | CCCC[Sn](OC(=O)C(CS)CCCCOC)(OC(=O)C(CS)CCCCOC)OC(=O)C(CS)CCCCOC |
| InChI | InChI=1S/3C8H16O3S.C4H9.Sn/c3*1-11-5-3-2-4-7(6-12)8(9)10;1-3-4-2;/h3*7,12H,2-6H2,1H3,(H,9,10);1,3-4H2,2H3;/q;;;;+3/p-3 |
| InChIKey | LLIBVDRNHISOQI-UHFFFAOYSA-K |
| XLogP | 5.44 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|