About methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate
methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate (PubChem CID 139683762) has the molecular formula C19H20O7
and a molecular weight of 360.36 g/mol. Its IUPAC name is methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate.
Molecular Properties
| Compound Name | methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate |
| PubChem CID | 139683762 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate |
| SMILES | CCCOc1cc(O)cc(C(=O)OC)c1C(=O)c1c(O)cc(C)cc1O |
| InChI | InChI=1S/C19H20O7/c1-4-5-26-15-9-11(20)8-12(19(24)25-3)16(15)18(23)17-13(21)6-10(2)7-14(17)22/h6-9,20-22H,4-5H2,1-3H3 |
| InChIKey | OMJFUDXWZLEKKT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate?
The IUPAC name of methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate (CID 139683762) is methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate.
What is the SMILES notation for methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate?
The canonical SMILES for methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate is CCCOc1cc(O)cc(C(=O)OC)c1C(=O)c1c(O)cc(C)cc1O.
What is the InChIKey of methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate?
The InChIKey is OMJFUDXWZLEKKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O7/c1-4-5-26-15-9-11(20)8-12(19(24)25-3)16(15)18(23)17-13(21)6-10(2)7-14(17)22/h6-9,20-22H,4-5H2,1-3H3.
What are the key properties of methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate?
methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate has a molecular weight of 360.36 g/mol, XLogP of 2.92, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-propoxybenzoate is sourced from PubChem (CID 139683762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).