About (1,6-dimethylcyclohexa-2,4-dien-1-yl) N,N-diethylcarbamate
(1,6-dimethylcyclohexa-2,4-dien-1-yl) N,N-diethylcarbamate (PubChem CID 139683813) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is (1,6-dimethylcyclohexa-2,4-dien-1-yl) N,N-diethylcarbamate.
Analyze (1,6-dimethylcyclohexa-2,4-dien-1-yl) N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,6-dimethylcyclohexa-2,4-dien-1-yl) N,N-diethylcarbamate?
The IUPAC name of (1,6-dimethylcyclohexa-2,4-dien-1-yl) N,N-diethylcarbamate (CID 139683813) is (1,6-dimethylcyclohexa-2,4-dien-1-yl) N,N-diethylcarbamate.
What is the SMILES notation for (1,6-dimethylcyclohexa-2,4-dien-1-yl) N,N-diethylcarbamate?
The canonical SMILES for (1,6-dimethylcyclohexa-2,4-dien-1-yl) N,N-diethylcarbamate is CCN(CC)C(=O)OC1(C)C=CC=CC1C.
What is the InChIKey of (1,6-dimethylcyclohexa-2,4-dien-1-yl) N,N-diethylcarbamate?
The InChIKey is OCSXUUYNYIAPHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO2/c1-5-14(6-2)12(15)16-13(4)10-8-7-9-11(13)3/h7-11H,5-6H2,1-4H3.
What are the key properties of (1,6-dimethylcyclohexa-2,4-dien-1-yl) N,N-diethylcarbamate?
(1,6-dimethylcyclohexa-2,4-dien-1-yl) N,N-diethylcarbamate has a molecular weight of 223.32 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,6-dimethylcyclohexa-2,4-dien-1-yl) N,N-diethylcarbamate is sourced from PubChem (CID 139683813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).