C8H14N2O — CID 139685100
(1S)-1-(1,6-diaminocyclohexa-2,4-dien-1-yl)ethanol (PubChem CID 139685100) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (1S)-1-(1,6-diaminocyclohexa-2,4-dien-1-yl)ethanol.
| Compound Name | (1S)-1-(1,6-diaminocyclohexa-2,4-dien-1-yl)ethanol |
|---|---|
| PubChem CID | 139685100 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (1S)-1-(1,6-diaminocyclohexa-2,4-dien-1-yl)ethanol |
| SMILES | C[C@H](O)C1(N)C=CC=CC1N |
| InChI | InChI=1S/C8H14N2O/c1-6(11)8(10)5-3-2-4-7(8)9/h2-7,11H,9-10H2,1H3/t6-,7?,8?/m0/s1 |
| InChIKey | CJNDBBJBMFVRGT-KKMMWDRVSA-N |
| XLogP | -0.48 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |