C28H21ClN2O3 — CID 139686991
1'-[N-chloro-3-(dimethylamino)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139686991) has the molecular formula C28H21ClN2O3 and a molecular weight of 468.94 g/mol. Its IUPAC name is 1'-[N-chloro-3-(dimethylamino)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 1'-[N-chloro-3-(dimethylamino)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139686991 |
| Molecular Formula | C28H21ClN2O3 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 1'-[N-chloro-3-(dimethylamino)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CN(C)c1cccc(N(Cl)c2cccc3c2C2(OC(=O)c4ccccc42)c2ccccc2O3)c1 |
| InChI | InChI=1S/C28H21ClN2O3/c1-30(2)18-9-7-10-19(17-18)31(29)23-14-8-16-25-26(23)28(22-13-5-6-15-24(22)33-25)21-12-4-3-11-20(21)27(32)34-28/h3-17H,1-2H3 |
| InChIKey | HQODPKLBTURNOL-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|