C35H40N3NaO7 — CID 139687125
sodium 2-[2-[[(2R)-1-[5-(2,6-dimethoxy-4-methylphenyl)pentylamino]-1-oxo-3-phenylmethoxypropan-2-yl]carbamoyl]indol-1-yl]acetate (PubChem CID 139687125) has the molecular formula C35H40N3NaO7 and a molecular weight of 637.71 g/mol. Its IUPAC name is sodium 2-[2-[[(2R)-1-[5-(2,6-dimethoxy-4-methylphenyl)pentylamino]-1-oxo-3-phenylmethoxypropan-2-yl]carbamoyl]indol-1-yl]acetate.
| Compound Name | sodium 2-[2-[[(2R)-1-[5-(2,6-dimethoxy-4-methylphenyl)pentylamino]-1-oxo-3-phenylmethoxypropan-2-yl]carbamoyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 139687125 |
| Molecular Formula | C35H40N3NaO7 |
| Molecular Weight | 637.71 g/mol |
| Exact Mass | 637.28 |
| IUPAC Name | sodium 2-[2-[[(2R)-1-[5-(2,6-dimethoxy-4-methylphenyl)pentylamino]-1-oxo-3-phenylmethoxypropan-2-yl]carbamoyl]indol-1-yl]acetate |
| SMILES | COc1cc(C)cc(OC)c1CCCCCNC(=O)[C@@H](COCc1ccccc1)NC(=O)c1cc2ccccc2n1CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C35H41N3O7.Na/c1-24-18-31(43-2)27(32(19-24)44-3)15-8-5-11-17-36-34(41)28(23-45-22-25-12-6-4-7-13-25)37-35(42)30-20-26-14-9-10-16-29(26)38(30)21-33(39)40;/h4,6-7,9-10,12-14,16,18-20,28H,5,8,11,15,17,21-23H2,1-3H3,(H,36,41)(H,37,42)(H,39,40);/q;+1/p-1/t28-;/m1./s1 |
| InChIKey | APAPVQADLXSAAH-LNLSOMNWSA-M |
| XLogP | 0.57 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.71 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|