C15H17N3 — CID 139687703
1,2-bis(6-methylidenecyclohexa-1,3-dien-1-yl)guanidine (PubChem CID 139687703) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 1,2-bis(6-methylidenecyclohexa-1,3-dien-1-yl)guanidine.
| Compound Name | 1,2-bis(6-methylidenecyclohexa-1,3-dien-1-yl)guanidine |
|---|---|
| PubChem CID | 139687703 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 1,2-bis(6-methylidenecyclohexa-1,3-dien-1-yl)guanidine |
| SMILES | C=C1CC=CC=C1/N=C(\N)NC1=CC=CCC1=C |
| InChI | InChI=1S/C15H17N3/c1-11-7-3-5-9-13(11)17-15(16)18-14-10-6-4-8-12(14)2/h3-6,9-10H,1-2,7-8H2,(H3,16,17,18) |
| InChIKey | JSFHNQZYYKEPNV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|