C26H24N2OS2 — CID 139688350
N-ethyl-3-phenyl-N-[[3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methoxy]phenyl]methyl]prop-2-yn-1-amine (PubChem CID 139688350) has the molecular formula C26H24N2OS2 and a molecular weight of 444.63 g/mol. Its IUPAC name is N-ethyl-3-phenyl-N-[[3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methoxy]phenyl]methyl]prop-2-yn-1-amine.
| Compound Name | N-ethyl-3-phenyl-N-[[3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methoxy]phenyl]methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 139688350 |
| Molecular Formula | C26H24N2OS2 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-ethyl-3-phenyl-N-[[3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methoxy]phenyl]methyl]prop-2-yn-1-amine |
| SMILES | CCN(CC#Cc1ccccc1)Cc1cccc(OCc2csc(-c3ccsc3)n2)c1 |
| InChI | InChI=1S/C26H24N2OS2/c1-2-28(14-7-11-21-8-4-3-5-9-21)17-22-10-6-12-25(16-22)29-18-24-20-31-26(27-24)23-13-15-30-19-23/h3-6,8-10,12-13,15-16,19-20H,2,14,17-18H2,1H3 |
| InChIKey | LWWKVVKYRQUPLC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|