C8H6ClNS2 — CID 139688379
5-(chloromethyl)-3-thiophen-3-yl-1,2-thiazole (PubChem CID 139688379) has the molecular formula C8H6ClNS2 and a molecular weight of 215.73 g/mol. Its IUPAC name is 5-(chloromethyl)-3-thiophen-3-yl-1,2-thiazole.
| Compound Name | 5-(chloromethyl)-3-thiophen-3-yl-1,2-thiazole |
|---|---|
| PubChem CID | 139688379 |
| Molecular Formula | C8H6ClNS2 |
| Molecular Weight | 215.73 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | 5-(chloromethyl)-3-thiophen-3-yl-1,2-thiazole |
| SMILES | ClCc1cc(-c2ccsc2)ns1 |
| InChI | InChI=1S/C8H6ClNS2/c9-4-7-3-8(10-12-7)6-1-2-11-5-6/h1-3,5H,4H2 |
| InChIKey | FVKKNOHNYAWSMP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.73 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|