C28H26N2OS — CID 139688385
N-ethyl-3-phenyl-N-[[3-[(2-thiophen-3-yl-4-pyridinyl)methoxy]phenyl]methyl]prop-2-yn-1-amine (PubChem CID 139688385) has the molecular formula C28H26N2OS and a molecular weight of 438.60 g/mol. Its IUPAC name is N-ethyl-3-phenyl-N-[[3-[(2-thiophen-3-yl-4-pyridinyl)methoxy]phenyl]methyl]prop-2-yn-1-amine.
| Compound Name | N-ethyl-3-phenyl-N-[[3-[(2-thiophen-3-yl-4-pyridinyl)methoxy]phenyl]methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 139688385 |
| Molecular Formula | C28H26N2OS |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-ethyl-3-phenyl-N-[[3-[(2-thiophen-3-yl-4-pyridinyl)methoxy]phenyl]methyl]prop-2-yn-1-amine |
| SMILES | CCN(CC#Cc1ccccc1)Cc1cccc(OCc2ccnc(-c3ccsc3)c2)c1 |
| InChI | InChI=1S/C28H26N2OS/c1-2-30(16-7-11-23-8-4-3-5-9-23)20-24-10-6-12-27(18-24)31-21-25-13-15-29-28(19-25)26-14-17-32-22-26/h3-6,8-10,12-15,17-19,22H,2,16,20-21H2,1H3 |
| InChIKey | IHUOGKCOJSXJDP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|