C18H25ClFNO3S — CID 139689445
propan-2-yl 2-[5-(butanoylamino)-2-chloro-4-fluorophenyl]sulfanylpentanoate (PubChem CID 139689445) has the molecular formula C18H25ClFNO3S and a molecular weight of 389.92 g/mol. Its IUPAC name is propan-2-yl 2-[5-(butanoylamino)-2-chloro-4-fluorophenyl]sulfanylpentanoate.
| Compound Name | propan-2-yl 2-[5-(butanoylamino)-2-chloro-4-fluorophenyl]sulfanylpentanoate |
|---|---|
| PubChem CID | 139689445 |
| Molecular Formula | C18H25ClFNO3S |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | propan-2-yl 2-[5-(butanoylamino)-2-chloro-4-fluorophenyl]sulfanylpentanoate |
| SMILES | CCCC(=O)Nc1cc(SC(CCC)C(=O)OC(C)C)c(Cl)cc1F |
| InChI | InChI=1S/C18H25ClFNO3S/c1-5-7-15(18(23)24-11(3)4)25-16-10-14(13(20)9-12(16)19)21-17(22)8-6-2/h9-11,15H,5-8H2,1-4H3,(H,21,22) |
| InChIKey | RCQUSGIIOUDPQC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |