C13H28O2 — CID 139690879
3,3-dimethoxy-2,2,6,6-tetramethylheptane (PubChem CID 139690879) has the molecular formula C13H28O2 and a molecular weight of 216.36 g/mol. Its IUPAC name is 3,3-dimethoxy-2,2,6,6-tetramethylheptane.
| Compound Name | 3,3-dimethoxy-2,2,6,6-tetramethylheptane |
|---|---|
| PubChem CID | 139690879 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | 3,3-dimethoxy-2,2,6,6-tetramethylheptane |
| SMILES | COC(CCC(C)(C)C)(OC)C(C)(C)C |
| InChI | InChI=1S/C13H28O2/c1-11(2,3)9-10-13(14-7,15-8)12(4,5)6/h9-10H2,1-8H3 |
| InChIKey | HKOCBGJBMFNPRR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|