C18H15N3O3S2 — CID 139692462
(7aR)-6-[(4-nitrophenyl)methyl]-3-phenyl-5-sulfanylidene-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one (PubChem CID 139692462) has the molecular formula C18H15N3O3S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is (7aR)-6-[(4-nitrophenyl)methyl]-3-phenyl-5-sulfanylidene-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one.
| Compound Name | (7aR)-6-[(4-nitrophenyl)methyl]-3-phenyl-5-sulfanylidene-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one |
|---|---|
| PubChem CID | 139692462 |
| Molecular Formula | C18H15N3O3S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | (7aR)-6-[(4-nitrophenyl)methyl]-3-phenyl-5-sulfanylidene-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one |
| SMILES | O=C1[C@@H]2CSC(c3ccccc3)N2C(=S)N1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15N3O3S2/c22-16-15-11-26-17(13-4-2-1-3-5-13)20(15)18(25)19(16)10-12-6-8-14(9-7-12)21(23)24/h1-9,15,17H,10-11H2/t15-,17?/m0/s1 |
| InChIKey | ZVQNAFYDHGSEOS-MYJWUSKBSA-N |
| XLogP | 3.34 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|