C12H12N2O6 — CID 139694411
1-[(3R)-3-ethoxycarbonyl-2,5-dioxopyrrolidin-3-yl]pyrrole-2-carboxylic acid (PubChem CID 139694411) has the molecular formula C12H12N2O6 and a molecular weight of 280.24 g/mol. Its IUPAC name is 1-[(3R)-3-ethoxycarbonyl-2,5-dioxopyrrolidin-3-yl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[(3R)-3-ethoxycarbonyl-2,5-dioxopyrrolidin-3-yl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 139694411 |
| Molecular Formula | C12H12N2O6 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-[(3R)-3-ethoxycarbonyl-2,5-dioxopyrrolidin-3-yl]pyrrole-2-carboxylic acid |
| SMILES | CCOC(=O)[C@@]1(n2cccc2C(=O)O)CC(=O)NC1=O |
| InChI | InChI=1S/C12H12N2O6/c1-2-20-11(19)12(6-8(15)13-10(12)18)14-5-3-4-7(14)9(16)17/h3-5H,2,6H2,1H3,(H,16,17)(H,13,15,18)/t12-/m1/s1 |
| InChIKey | WXEBRAMSJCWJKR-GFCCVEGCSA-N |
| XLogP | -0.51 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|