C15H8Br2Cl4O — CID 139698602
bis[3-(bromomethyl)-2,6-dichlorophenyl]methanone (PubChem CID 139698602) has the molecular formula C15H8Br2Cl4O and a molecular weight of 505.85 g/mol. Its IUPAC name is bis[3-(bromomethyl)-2,6-dichlorophenyl]methanone.
| Compound Name | bis[3-(bromomethyl)-2,6-dichlorophenyl]methanone |
|---|---|
| PubChem CID | 139698602 |
| Molecular Formula | C15H8Br2Cl4O |
| Molecular Weight | 505.85 g/mol |
| Exact Mass | 501.77 |
| IUPAC Name | bis[3-(bromomethyl)-2,6-dichlorophenyl]methanone |
| SMILES | O=C(c1c(Cl)ccc(CBr)c1Cl)c1c(Cl)ccc(CBr)c1Cl |
| InChI | InChI=1S/C15H8Br2Cl4O/c16-5-7-1-3-9(18)11(13(7)20)15(22)12-10(19)4-2-8(6-17)14(12)21/h1-4H,5-6H2 |
| InChIKey | SUWHDJYGIHOVAC-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.85 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|