C19H28N4O4 — CID 139699368
methyl 2-[4-[(4-pyridin-4-ylpiperazine-1-carbonyl)amino]cyclohexyl]oxyacetate (PubChem CID 139699368) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is methyl 2-[4-[(4-pyridin-4-ylpiperazine-1-carbonyl)amino]cyclohexyl]oxyacetate.
| Compound Name | methyl 2-[4-[(4-pyridin-4-ylpiperazine-1-carbonyl)amino]cyclohexyl]oxyacetate |
|---|---|
| PubChem CID | 139699368 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | methyl 2-[4-[(4-pyridin-4-ylpiperazine-1-carbonyl)amino]cyclohexyl]oxyacetate |
| SMILES | COC(=O)COC1CCC(NC(=O)N2CCN(c3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C19H28N4O4/c1-26-18(24)14-27-17-4-2-15(3-5-17)21-19(25)23-12-10-22(11-13-23)16-6-8-20-9-7-16/h6-9,15,17H,2-5,10-14H2,1H3,(H,21,25) |
| InChIKey | XYCMFJYDMQPXKA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |