C23H23N3O3 — CID 139700946
2-[1-[4-(4-aminophenoxy)phenyl]propyl]benzene-1,4-dicarboxamide (PubChem CID 139700946) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-[1-[4-(4-aminophenoxy)phenyl]propyl]benzene-1,4-dicarboxamide.
| Compound Name | 2-[1-[4-(4-aminophenoxy)phenyl]propyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 139700946 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-[1-[4-(4-aminophenoxy)phenyl]propyl]benzene-1,4-dicarboxamide |
| SMILES | CCC(c1ccc(Oc2ccc(N)cc2)cc1)c1cc(C(N)=O)ccc1C(N)=O |
| InChI | InChI=1S/C23H23N3O3/c1-2-19(21-13-15(22(25)27)5-12-20(21)23(26)28)14-3-8-17(9-4-14)29-18-10-6-16(24)7-11-18/h3-13,19H,2,24H2,1H3,(H2,25,27)(H2,26,28) |
| InChIKey | WONPMPZXKVVWGE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|