About 3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide
3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide (PubChem CID 139702542) has the molecular formula C19H15FN4O2
and a molecular weight of 350.35 g/mol. Its IUPAC name is 3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide.
Molecular Properties
| Compound Name | 3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide |
| PubChem CID | 139702542 |
| Molecular Formula | C19H15FN4O2 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide |
| SMILES | N/C(=N\N(c1ccccc1)c1ccc([N+](=O)[O-])cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C19H15FN4O2/c20-15-6-4-5-14(13-15)19(21)22-23(16-7-2-1-3-8-16)17-9-11-18(12-10-17)24(25)26/h1-13H,(H2,21,22) |
| InChIKey | BYAQFMPSPXDLSR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 84.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide?
The IUPAC name of 3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide (CID 139702542) is 3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide.
What is the SMILES notation for 3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide?
The canonical SMILES for 3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide is N/C(=N\N(c1ccccc1)c1ccc([N+](=O)[O-])cc1)c1cccc(F)c1.
What is the InChIKey of 3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide?
The InChIKey is BYAQFMPSPXDLSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FN4O2/c20-15-6-4-5-14(13-15)19(21)22-23(16-7-2-1-3-8-16)17-9-11-18(12-10-17)24(25)26/h1-13H,(H2,21,22).
What are the key properties of 3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide?
3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide has a molecular weight of 350.35 g/mol, XLogP of 4.19, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N'-(N-(4-nitrophenyl)anilino)benzenecarboximidamide is sourced from PubChem (CID 139702542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).