C13H9ClF3N3O5S — CID 139704256
methyl 5-(5-chloropyrimidin-2-yl)oxy-2-(trifluoromethylsulfonylamino)benzoate (PubChem CID 139704256) has the molecular formula C13H9ClF3N3O5S and a molecular weight of 411.75 g/mol. Its IUPAC name is methyl 5-(5-chloropyrimidin-2-yl)oxy-2-(trifluoromethylsulfonylamino)benzoate.
| Compound Name | methyl 5-(5-chloropyrimidin-2-yl)oxy-2-(trifluoromethylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 139704256 |
| Molecular Formula | C13H9ClF3N3O5S |
| Molecular Weight | 411.75 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | methyl 5-(5-chloropyrimidin-2-yl)oxy-2-(trifluoromethylsulfonylamino)benzoate |
| SMILES | COC(=O)c1cc(Oc2ncc(Cl)cn2)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H9ClF3N3O5S/c1-24-11(21)9-4-8(25-12-18-5-7(14)6-19-12)2-3-10(9)20-26(22,23)13(15,16)17/h2-6,20H,1H3 |
| InChIKey | BFEYOTPXORYKDZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |