C6H11NS3 — CID 139704325
(4S)-4-(2-methylsulfanylethyl)-1,3-thiazolidine-2-thione (PubChem CID 139704325) has the molecular formula C6H11NS3 and a molecular weight of 193.36 g/mol. Its IUPAC name is (4S)-4-(2-methylsulfanylethyl)-1,3-thiazolidine-2-thione.
| Compound Name | (4S)-4-(2-methylsulfanylethyl)-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 139704325 |
| Molecular Formula | C6H11NS3 |
| Molecular Weight | 193.36 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | (4S)-4-(2-methylsulfanylethyl)-1,3-thiazolidine-2-thione |
| SMILES | CSCC[C@H]1CSC(=S)N1 |
| InChI | InChI=1S/C6H11NS3/c1-9-3-2-5-4-10-6(8)7-5/h5H,2-4H2,1H3,(H,7,8)/t5-/m0/s1 |
| InChIKey | CJNFYNGBLZWDLW-YFKPBYRVSA-N |
| XLogP | 1.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|