About O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate
O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate (PubChem CID 139704675) has the molecular formula C20H25NO2S
and a molecular weight of 343.49 g/mol. Its IUPAC name is O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate.
Molecular Properties
| Compound Name | O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate |
| PubChem CID | 139704675 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate |
| SMILES | COc1cccc(CN(C)C(=S)Oc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C20H25NO2S/c1-20(2,3)16-9-11-17(12-10-16)23-19(24)21(4)14-15-7-6-8-18(13-15)22-5/h6-13H,14H2,1-5H3 |
| InChIKey | FMVCHTASFDORHZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate?
The IUPAC name of O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate (CID 139704675) is O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate.
What is the SMILES notation for O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate?
The canonical SMILES for O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate is COc1cccc(CN(C)C(=S)Oc2ccc(C(C)(C)C)cc2)c1.
What is the InChIKey of O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate?
The InChIKey is FMVCHTASFDORHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO2S/c1-20(2,3)16-9-11-17(12-10-16)23-19(24)21(4)14-15-7-6-8-18(13-15)22-5/h6-13H,14H2,1-5H3.
What are the key properties of O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate?
O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate has a molecular weight of 343.49 g/mol, XLogP of 4.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(4-tert-butylphenyl) N-[(3-methoxyphenyl)methyl]-N-methylcarbamothioate is sourced from PubChem (CID 139704675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).