C11H16N2OS — CID 7944505
1-[(3-methoxyphenyl)methyl]-1,3-dimethylthiourea (PubChem CID 7944505) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-1,3-dimethylthiourea.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-1,3-dimethylthiourea |
|---|---|
| PubChem CID | 7944505 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-1,3-dimethylthiourea |
| SMILES | CNC(=S)N(C)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C11H16N2OS/c1-12-11(15)13(2)8-9-5-4-6-10(7-9)14-3/h4-7H,8H2,1-3H3,(H,12,15) |
| InChIKey | IIZJWEYFHWVKMA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|