C11H13N2NaO6S — CID 139710117
sodium [2-methoxycarbonyl-4-[methoxycarbonyl(methyl)amino]phenyl]sulfonylazanide (PubChem CID 139710117) has the molecular formula C11H13N2NaO6S and a molecular weight of 324.29 g/mol. Its IUPAC name is sodium [2-methoxycarbonyl-4-[methoxycarbonyl(methyl)amino]phenyl]sulfonylazanide.
| Compound Name | sodium [2-methoxycarbonyl-4-[methoxycarbonyl(methyl)amino]phenyl]sulfonylazanide |
|---|---|
| PubChem CID | 139710117 |
| Molecular Formula | C11H13N2NaO6S |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | sodium [2-methoxycarbonyl-4-[methoxycarbonyl(methyl)amino]phenyl]sulfonylazanide |
| SMILES | COC(=O)c1cc(N(C)C(=O)OC)ccc1S([NH-])(=O)=O.[Na+] |
| InChI | InChI=1S/C11H13N2O6S.Na/c1-13(11(15)19-3)7-4-5-9(20(12,16)17)8(6-7)10(14)18-2;/h4-6H,1-3H3,(H-,12,16,17);/q-1;+1 |
| InChIKey | VMGXRGJNTYBQAK-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 113.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |