About ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium
ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium (PubChem CID 159441168) has the molecular formula C15H25I3N3O4SV
and a molecular weight of 775.10 g/mol. Its IUPAC name is ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium.
Molecular Properties
| Compound Name | ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium |
| PubChem CID | 159441168 |
| Molecular Formula | C15H25I3N3O4SV |
| Molecular Weight | 775.10 g/mol |
| Exact Mass | 774.81 |
| IUPAC Name | ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium |
| SMILES | CC.CNS(=O)(=O)c1cc(N(C)N=C(C)C)ccc1C(=O)OC.I[V](I)I |
| InChI | InChI=1S/C13H19N3O4S.C2H6.3HI.V/c1-9(2)15-16(4)10-6-7-11(13(17)20-5)12(8-10)21(18,19)14-3;1-2;;;;/h6-8,14H,1-5H3;1-2H3;3*1H;/q;;;;;+3/p-3 |
| InChIKey | LSERLLLBLRORME-UHFFFAOYSA-K |
| XLogP | 4.89 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 775.10 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium?
The IUPAC name of ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium (CID 159441168) is ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium.
What is the SMILES notation for ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium?
The canonical SMILES for ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium is CC.CNS(=O)(=O)c1cc(N(C)N=C(C)C)ccc1C(=O)OC.I[V](I)I.
What is the InChIKey of ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium?
The InChIKey is LSERLLLBLRORME-UHFFFAOYSA-K. The full InChI is InChI=1S/C13H19N3O4S.C2H6.3HI.V/c1-9(2)15-16(4)10-6-7-11(13(17)20-5)12(8-10)21(18,19)14-3;1-2;;;;/h6-8,14H,1-5H3;1-2H3;3*1H;/q;;;;;+3/p-3.
What are the key properties of ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium?
ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium has a molecular weight of 775.10 g/mol, XLogP of 4.89, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 4-[methyl-(propan-2-ylideneamino)amino]-2-(methylsulfamoyl)benzoate;triiodovanadium is sourced from PubChem (CID 159441168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).