C11H9NO7S — CID 12802659
dimethyl 2-isocyanatosulfonylbenzene-1,4-dicarboxylate (PubChem CID 12802659) has the molecular formula C11H9NO7S and a molecular weight of 299.26 g/mol. Its IUPAC name is dimethyl 2-isocyanatosulfonylbenzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-isocyanatosulfonylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 12802659 |
| Molecular Formula | C11H9NO7S |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | dimethyl 2-isocyanatosulfonylbenzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(S(=O)(=O)N=C=O)c1 |
| InChI | InChI=1S/C11H9NO7S/c1-18-10(14)7-3-4-8(11(15)19-2)9(5-7)20(16,17)12-6-13/h3-5H,1-2H3 |
| InChIKey | LMLFQCCJAPTXDR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 116.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|