C17H15BrN2O7S — CID 26951548
dimethyl 2-[[(4-bromobenzoyl)amino]sulfamoyl]benzene-1,4-dicarboxylate (PubChem CID 26951548) has the molecular formula C17H15BrN2O7S and a molecular weight of 471.29 g/mol. Its IUPAC name is dimethyl 2-[[(4-bromobenzoyl)amino]sulfamoyl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[(4-bromobenzoyl)amino]sulfamoyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 26951548 |
| Molecular Formula | C17H15BrN2O7S |
| Molecular Weight | 471.29 g/mol |
| Exact Mass | 469.98 |
| IUPAC Name | dimethyl 2-[[(4-bromobenzoyl)amino]sulfamoyl]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(S(=O)(=O)NNC(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H15BrN2O7S/c1-26-16(22)11-5-8-13(17(23)27-2)14(9-11)28(24,25)20-19-15(21)10-3-6-12(18)7-4-10/h3-9,20H,1-2H3,(H,19,21) |
| InChIKey | XATQFOYESIJGKG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|