C12H18F6N2 — CID 139714683
1-but-2-enyl-4-(2,2,3,4,4,4-hexafluorobutyl)piperazine (PubChem CID 139714683) has the molecular formula C12H18F6N2 and a molecular weight of 304.28 g/mol. Its IUPAC name is 1-but-2-enyl-4-(2,2,3,4,4,4-hexafluorobutyl)piperazine.
| Compound Name | 1-but-2-enyl-4-(2,2,3,4,4,4-hexafluorobutyl)piperazine |
|---|---|
| PubChem CID | 139714683 |
| Molecular Formula | C12H18F6N2 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-but-2-enyl-4-(2,2,3,4,4,4-hexafluorobutyl)piperazine |
| SMILES | CC=CCN1CCN(CC(F)(F)C(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H18F6N2/c1-2-3-4-19-5-7-20(8-6-19)9-11(14,15)10(13)12(16,17)18/h2-3,10H,4-9H2,1H3 |
| InChIKey | JWBXPSQVVYTWMZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|