C15H31N2+ — CID 162410059
1,4-dibutyl-1-prop-2-enylpiperazin-1-ium (PubChem CID 162410059) has the molecular formula C15H31N2+ and a molecular weight of 239.43 g/mol. Its IUPAC name is 1,4-dibutyl-1-prop-2-enylpiperazin-1-ium.
| Compound Name | 1,4-dibutyl-1-prop-2-enylpiperazin-1-ium |
|---|---|
| PubChem CID | 162410059 |
| Molecular Formula | C15H31N2+ |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.25 |
| IUPAC Name | 1,4-dibutyl-1-prop-2-enylpiperazin-1-ium |
| SMILES | C=CC[N+]1(CCCC)CCN(CCCC)CC1 |
| InChI | InChI=1S/C15H31N2/c1-4-7-9-16-10-14-17(12-6-3,15-11-16)13-8-5-2/h6H,3-5,7-15H2,1-2H3/q+1 |
| InChIKey | XCRALMFKOONKGX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|