C15H17BrN2O2 — CID 139715882
4a-bromo-1-(methoxymethyl)-1-methyl-3,4-dihydropyrido[3,4-b]indole-2-carbaldehyde (PubChem CID 139715882) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is 4a-bromo-1-(methoxymethyl)-1-methyl-3,4-dihydropyrido[3,4-b]indole-2-carbaldehyde.
| Compound Name | 4a-bromo-1-(methoxymethyl)-1-methyl-3,4-dihydropyrido[3,4-b]indole-2-carbaldehyde |
|---|---|
| PubChem CID | 139715882 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 4a-bromo-1-(methoxymethyl)-1-methyl-3,4-dihydropyrido[3,4-b]indole-2-carbaldehyde |
| SMILES | COCC1(C)C2=Nc3ccccc3C2(Br)CCN1C=O |
| InChI | InChI=1S/C15H17BrN2O2/c1-14(9-20-2)13-15(16,7-8-18(14)10-19)11-5-3-4-6-12(11)17-13/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | BBBGVJGMJYMGKZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|