C15H15BrN2O3 — CID 14699425
methyl 4a-bromo-2-formyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carboxylate (PubChem CID 14699425) has the molecular formula C15H15BrN2O3 and a molecular weight of 351.20 g/mol. Its IUPAC name is methyl 4a-bromo-2-formyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carboxylate.
| Compound Name | methyl 4a-bromo-2-formyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carboxylate |
|---|---|
| PubChem CID | 14699425 |
| Molecular Formula | C15H15BrN2O3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | methyl 4a-bromo-2-formyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carboxylate |
| SMILES | COC(=O)C1(C)C2=Nc3ccccc3C2(Br)CCN1C=O |
| InChI | InChI=1S/C15H15BrN2O3/c1-14(13(20)21-2)12-15(16,7-8-18(14)9-19)10-5-3-4-6-11(10)17-12/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | TYDCTMQYGCKSLW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|