C25H30O5 — CID 139716594
methyl 4-[1-[2-(2,2-dimethoxyethyl)-4,4-dimethyl-2,3-dihydrochromen-6-yl]ethenyl]benzoate (PubChem CID 139716594) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is methyl 4-[1-[2-(2,2-dimethoxyethyl)-4,4-dimethyl-2,3-dihydrochromen-6-yl]ethenyl]benzoate.
| Compound Name | methyl 4-[1-[2-(2,2-dimethoxyethyl)-4,4-dimethyl-2,3-dihydrochromen-6-yl]ethenyl]benzoate |
|---|---|
| PubChem CID | 139716594 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | methyl 4-[1-[2-(2,2-dimethoxyethyl)-4,4-dimethyl-2,3-dihydrochromen-6-yl]ethenyl]benzoate |
| SMILES | C=C(c1ccc(C(=O)OC)cc1)c1ccc2c(c1)C(C)(C)CC(CC(OC)OC)O2 |
| InChI | InChI=1S/C25H30O5/c1-16(17-7-9-18(10-8-17)24(26)29-6)19-11-12-22-21(13-19)25(2,3)15-20(30-22)14-23(27-4)28-5/h7-13,20,23H,1,14-15H2,2-6H3 |
| InChIKey | IEUIZXNUGHJSDH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|