C18H26O5 — CID 139720621
3-[[2,3-bis(ethenyl)-2,3-dihydroxypent-4-enoxy]methyl]-4-ethenylhexa-1,5-diene-3,4-diol (PubChem CID 139720621) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 3-[[2,3-bis(ethenyl)-2,3-dihydroxypent-4-enoxy]methyl]-4-ethenylhexa-1,5-diene-3,4-diol.
| Compound Name | 3-[[2,3-bis(ethenyl)-2,3-dihydroxypent-4-enoxy]methyl]-4-ethenylhexa-1,5-diene-3,4-diol |
|---|---|
| PubChem CID | 139720621 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 3-[[2,3-bis(ethenyl)-2,3-dihydroxypent-4-enoxy]methyl]-4-ethenylhexa-1,5-diene-3,4-diol |
| SMILES | C=CC(O)(C=C)C(O)(C=C)COCC(O)(C=C)C(O)(C=C)C=C |
| InChI | InChI=1S/C18H26O5/c1-7-15(19,8-2)17(21,11-5)13-23-14-18(22,12-6)16(20,9-3)10-4/h7-12,19-22H,1-6,13-14H2 |
| InChIKey | ZSZVSCGNIPBTGY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|