C17H22Cl3N3O7S — CID 139725830
2,2,2-trichloroethyl (6R)-3-(carbamoyloxymethyl)-8-oxo-4-(pentoxycarbonylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139725830) has the molecular formula C17H22Cl3N3O7S and a molecular weight of 518.80 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6R)-3-(carbamoyloxymethyl)-8-oxo-4-(pentoxycarbonylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6R)-3-(carbamoyloxymethyl)-8-oxo-4-(pentoxycarbonylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139725830 |
| Molecular Formula | C17H22Cl3N3O7S |
| Molecular Weight | 518.80 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | 2,2,2-trichloroethyl (6R)-3-(carbamoyloxymethyl)-8-oxo-4-(pentoxycarbonylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCCCCOC(=O)NC1S[C@@H]2CC(=O)N2C(C(=O)OCC(Cl)(Cl)Cl)=C1COC(N)=O |
| InChI | InChI=1S/C17H22Cl3N3O7S/c1-2-3-4-5-28-16(27)22-13-9(7-29-15(21)26)12(14(25)30-8-17(18,19)20)23-10(24)6-11(23)31-13/h11,13H,2-8H2,1H3,(H2,21,26)(H,22,27)/t11-,13?/m1/s1 |
| InChIKey | NTVJEZLQETYTPY-JTDNENJMSA-N |
| XLogP | 2.80 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|