C28H29N5O7S — CID 139726087
(4-nitrophenyl)methyl (4R,5S,6S)-3-[(2-benzamido-1,4,5,6-tetrahydropyrimidin-5-yl)sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 139726087) has the molecular formula C28H29N5O7S and a molecular weight of 579.64 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4R,5S,6S)-3-[(2-benzamido-1,4,5,6-tetrahydropyrimidin-5-yl)sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (4R,5S,6S)-3-[(2-benzamido-1,4,5,6-tetrahydropyrimidin-5-yl)sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139726087 |
| Molecular Formula | C28H29N5O7S |
| Molecular Weight | 579.64 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | (4-nitrophenyl)methyl (4R,5S,6S)-3-[(2-benzamido-1,4,5,6-tetrahydropyrimidin-5-yl)sulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(SC3CN=C(NC(=O)c4ccccc4)NC3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C28H29N5O7S/c1-15-22-21(16(2)34)26(36)32(22)23(27(37)40-14-17-8-10-19(11-9-17)33(38)39)24(15)41-20-12-29-28(30-13-20)31-25(35)18-6-4-3-5-7-18/h3-11,15-16,20-22,34H,12-14H2,1-2H3,(H2,29,30,31,35)/t15-,16-,21-,22-/m1/s1 |
| InChIKey | RWXHRJMLCYSMOK-AHWCRGGASA-N |
| XLogP | 2.20 |
| TPSA | 163.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|