C31H28N2O3 — CID 139727163
7'-amino-1'-(2,4-dimethyl-3-propylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139727163) has the molecular formula C31H28N2O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is 7'-amino-1'-(2,4-dimethyl-3-propylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 7'-amino-1'-(2,4-dimethyl-3-propylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139727163 |
| Molecular Formula | C31H28N2O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 7'-amino-1'-(2,4-dimethyl-3-propylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCc1c(C)ccc(Nc2cccc3c2C2(OC(=O)c4ccccc42)c2cc(N)ccc2O3)c1C |
| InChI | InChI=1S/C31H28N2O3/c1-4-8-21-18(2)13-15-25(19(21)3)33-26-11-7-12-28-29(26)31(24-17-20(32)14-16-27(24)35-28)23-10-6-5-9-22(23)30(34)36-31/h5-7,9-17,33H,4,8,32H2,1-3H3 |
| InChIKey | OSRYYBWDPIVWHE-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|