C32H30N2O3 — CID 139727146
1'-[2-(diethylamino)-4-ethylanilino]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139727146) has the molecular formula C32H30N2O3 and a molecular weight of 490.60 g/mol. Its IUPAC name is 1'-[2-(diethylamino)-4-ethylanilino]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 1'-[2-(diethylamino)-4-ethylanilino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139727146 |
| Molecular Formula | C32H30N2O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 1'-[2-(diethylamino)-4-ethylanilino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCc1ccc(Nc2cccc3c2C2(OC(=O)c4ccccc42)c2ccccc2O3)c(N(CC)CC)c1 |
| InChI | InChI=1S/C32H30N2O3/c1-4-21-18-19-25(27(20-21)34(5-2)6-3)33-26-15-11-17-29-30(26)32(24-14-9-10-16-28(24)36-29)23-13-8-7-12-22(23)31(35)37-32/h7-20,33H,4-6H2,1-3H3 |
| InChIKey | CKTBJQBKJVWJOR-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |