C68H26BF20IS2 — CID 139729257
bis(5-tetracen-5-ylthiophen-2-yl)iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139729257) has the molecular formula C68H26BF20IS2 and a molecular weight of 1424.77 g/mol. Its IUPAC name is bis(5-tetracen-5-ylthiophen-2-yl)iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | bis(5-tetracen-5-ylthiophen-2-yl)iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139729257 |
| Molecular Formula | C68H26BF20IS2 |
| Molecular Weight | 1424.77 g/mol |
| Exact Mass | 1424.03 |
| IUPAC Name | bis(5-tetracen-5-ylthiophen-2-yl)iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.c1ccc2cc3c(-c4ccc([I+]c5ccc(-c6c7ccccc7cc7cc8ccccc8cc67)s5)s4)c4ccccc4cc3cc2c1 |
| InChI | InChI=1S/C44H26IS2.C24BF20/c1-3-11-29-25-37-33(21-27(29)9-1)23-31-13-5-7-15-35(31)43(37)39-17-19-41(46-39)45-42-20-18-40(47-42)44-36-16-8-6-14-32(36)24-34-22-28-10-2-4-12-30(28)26-38(34)44;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h1-26H;/q+1;-1 |
| InChIKey | DDWVZZDGCPMNRA-UHFFFAOYSA-N |
| XLogP | 16.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1424.77 |
| LogP ≤ 5 | 16.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|