C61H28BF20P — CID 139734655
tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;triphenyl(tetracen-5-ylmethyl)phosphanium (PubChem CID 139734655) has the molecular formula C61H28BF20P and a molecular weight of 1182.64 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;triphenyl(tetracen-5-ylmethyl)phosphanium.
| Compound Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;triphenyl(tetracen-5-ylmethyl)phosphanium |
|---|---|
| PubChem CID | 139734655 |
| Molecular Formula | C61H28BF20P |
| Molecular Weight | 1182.64 g/mol |
| Exact Mass | 1182.17 |
| IUPAC Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;triphenyl(tetracen-5-ylmethyl)phosphanium |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.c1ccc([P+](Cc2c3ccccc3cc3cc4ccccc4cc23)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H28P.C24BF20/c1-4-17-32(18-5-1)38(33-19-6-2-7-20-33,34-21-8-3-9-22-34)27-37-35-23-13-12-16-30(35)25-31-24-28-14-10-11-15-29(28)26-36(31)37;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h1-26H,27H2;/q+1;-1 |
| InChIKey | STGSURDDPSRIPZ-UHFFFAOYSA-N |
| XLogP | 14.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1182.64 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|