C25H40N2OSi2 — CID 139729463
1,5-bis[1-azabicyclo[3.2.1]octan-5-ylmethyl(dimethyl)silyl]penta-1,4-diyn-3-one (PubChem CID 139729463) has the molecular formula C25H40N2OSi2 and a molecular weight of 440.78 g/mol. Its IUPAC name is 1,5-bis[1-azabicyclo[3.2.1]octan-5-ylmethyl(dimethyl)silyl]penta-1,4-diyn-3-one.
| Compound Name | 1,5-bis[1-azabicyclo[3.2.1]octan-5-ylmethyl(dimethyl)silyl]penta-1,4-diyn-3-one |
|---|---|
| PubChem CID | 139729463 |
| Molecular Formula | C25H40N2OSi2 |
| Molecular Weight | 440.78 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 1,5-bis[1-azabicyclo[3.2.1]octan-5-ylmethyl(dimethyl)silyl]penta-1,4-diyn-3-one |
| SMILES | C[Si](C)(C#CC(=O)C#C[Si](C)(C)CC12CCCN(CC1)C2)CC12CCCN(CC1)C2 |
| InChI | InChI=1S/C25H40N2OSi2/c1-29(2,21-24-9-5-13-26(19-24)15-11-24)17-7-23(28)8-18-30(3,4)22-25-10-6-14-27(20-25)16-12-25/h5-6,9-16,19-22H2,1-4H3 |
| InChIKey | JSNKZQATLWNACB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.78 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|