C11H14N2O5 — CID 19814775
5-(1-azabicyclo[3.1.1]heptan-5-yl)-1,3-oxazole;oxalic acid (PubChem CID 19814775) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 5-(1-azabicyclo[3.1.1]heptan-5-yl)-1,3-oxazole;oxalic acid.
| Compound Name | 5-(1-azabicyclo[3.1.1]heptan-5-yl)-1,3-oxazole;oxalic acid |
|---|---|
| PubChem CID | 19814775 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-(1-azabicyclo[3.1.1]heptan-5-yl)-1,3-oxazole;oxalic acid |
| SMILES | O=C(O)C(=O)O.c1ncc(C23CCCN(C2)C3)o1 |
| InChI | InChI=1S/C9H12N2O.C2H2O4/c1-2-9(5-11(3-1)6-9)8-4-10-7-12-8;3-1(4)2(5)6/h4,7H,1-3,5-6H2;(H,3,4)(H,5,6) |
| InChIKey | DUYPHUORTOAUQS-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|