C16H19BrN2O — CID 69060308
5-[6-(furan-3-yl)-3-pyridinyl]-1-azabicyclo[3.2.1]octane;hydrobromide (PubChem CID 69060308) has the molecular formula C16H19BrN2O and a molecular weight of 335.25 g/mol. Its IUPAC name is 5-[6-(furan-3-yl)-3-pyridinyl]-1-azabicyclo[3.2.1]octane;hydrobromide.
| Compound Name | 5-[6-(furan-3-yl)-3-pyridinyl]-1-azabicyclo[3.2.1]octane;hydrobromide |
|---|---|
| PubChem CID | 69060308 |
| Molecular Formula | C16H19BrN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 5-[6-(furan-3-yl)-3-pyridinyl]-1-azabicyclo[3.2.1]octane;hydrobromide |
| SMILES | Br.c1cc(-c2ccc(C34CCCN(CC3)C4)cn2)co1 |
| InChI | InChI=1S/C16H18N2O.BrH/c1-5-16(6-8-18(7-1)12-16)14-2-3-15(17-10-14)13-4-9-19-11-13;/h2-4,9-11H,1,5-8,12H2;1H |
| InChIKey | LSULVZAKGMSMEW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |