C14H23NO4 — CID 139730431
tert-butyl (2S)-1-[(E)-3-methoxy-3-oxoprop-1-enyl]piperidine-2-carboxylate (PubChem CID 139730431) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(E)-3-methoxy-3-oxoprop-1-enyl]piperidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(E)-3-methoxy-3-oxoprop-1-enyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 139730431 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | tert-butyl (2S)-1-[(E)-3-methoxy-3-oxoprop-1-enyl]piperidine-2-carboxylate |
| SMILES | COC(=O)/C=C/N1CCCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO4/c1-14(2,3)19-13(17)11-7-5-6-9-15(11)10-8-12(16)18-4/h8,10-11H,5-7,9H2,1-4H3/b10-8+/t11-/m0/s1 |
| InChIKey | IGDCEAACECSTNN-UQSGXBNBSA-N |
| XLogP | 1.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|