C20H22NO3+ — CID 139731654
cyclohexyl 1-phenacylpyridin-1-ium-2-carboxylate (PubChem CID 139731654) has the molecular formula C20H22NO3+ and a molecular weight of 324.40 g/mol. Its IUPAC name is cyclohexyl 1-phenacylpyridin-1-ium-2-carboxylate.
| Compound Name | cyclohexyl 1-phenacylpyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 139731654 |
| Molecular Formula | C20H22NO3+ |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | cyclohexyl 1-phenacylpyridin-1-ium-2-carboxylate |
| SMILES | O=C(C[n+]1ccccc1C(=O)OC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H22NO3/c22-19(16-9-3-1-4-10-16)15-21-14-8-7-13-18(21)20(23)24-17-11-5-2-6-12-17/h1,3-4,7-10,13-14,17H,2,5-6,11-12,15H2/q+1 |
| InChIKey | CQGGFGFJYBWQHK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|