About CID 139732941
CID 139732941 (PubChem CID 139732941) has the molecular formula C61H40BF24NO2S
and a molecular weight of 1317.83 g/mol.
Molecular Properties
| Compound Name | CID 139732941 |
| PubChem CID | 139732941 |
| Molecular Formula | C61H40BF24NO2S |
| Molecular Weight | 1317.83 g/mol |
| Exact Mass | 1317.25 |
| IUPAC Name | — |
| SMILES | C[S+](=O)(CC(=O)c1ccc(N(Cc2ccccc2)Cc2ccccc2)cc1)c1ccccc1.FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H12BF24.C29H28NO2S/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;1-33(32,28-15-9-4-10-16-28)23-29(31)26-17-19-27(20-18-26)30(21-24-11-5-2-6-12-24)22-25-13-7-3-8-14-25/h1-12H;2-20H,21-23H2,1H3/q-1;+1 |
| InChIKey | WTZGZOWDXAFMJH-UHFFFAOYSA-N |
| XLogP | 17.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 90 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1317.83 |
| LogP ≤ 5 | 17.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 139732941 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139732941?
The IUPAC name of CID 139732941 (CID 139732941) is not available.
What is the SMILES notation for CID 139732941?
The canonical SMILES for CID 139732941 is C[S+](=O)(CC(=O)c1ccc(N(Cc2ccccc2)Cc2ccccc2)cc1)c1ccccc1.FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1.
What is the InChIKey of CID 139732941?
The InChIKey is WTZGZOWDXAFMJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H12BF24.C29H28NO2S/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;1-33(32,28-15-9-4-10-16-28)23-29(31)26-17-19-27(20-18-26)30(21-24-11-5-2-6-12-24)22-25-13-7-3-8-14-25/h1-12H;2-20H,21-23H2,1H3/q-1;+1.
What are the key properties of CID 139732941?
CID 139732941 has a molecular weight of 1317.83 g/mol, XLogP of 17.48, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139732941 is sourced from PubChem (CID 139732941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).