About CID 139733633
CID 139733633 (PubChem CID 139733633) has the molecular formula C40H30BF8NO2S
and a molecular weight of 751.55 g/mol.
Molecular Properties
| Compound Name | CID 139733633 |
| PubChem CID | 139733633 |
| Molecular Formula | C40H30BF8NO2S |
| Molecular Weight | 751.55 g/mol |
| Exact Mass | 751.20 |
| IUPAC Name | — |
| SMILES | Fc1c(F)c(F)c([B-](F)(F)F)c(F)c1F.O=C(C[S+](=O)(c1ccccc1)c1ccccc1)c1ccc(N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C34H30NO2S.C6BF8/c36-34(27-38(37,32-17-9-3-10-18-32)33-19-11-4-12-20-33)30-21-23-31(24-22-30)35(25-28-13-5-1-6-14-28)26-29-15-7-2-8-16-29;8-2-1(7(13,14)15)3(9)5(11)6(12)4(2)10/h1-24H,25-27H2;/q+1;-1 |
| InChIKey | BYSBCQRLDZBGRK-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 751.55 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 139733633 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139733633?
The IUPAC name of CID 139733633 (CID 139733633) is not available.
What is the SMILES notation for CID 139733633?
The canonical SMILES for CID 139733633 is Fc1c(F)c(F)c([B-](F)(F)F)c(F)c1F.O=C(C[S+](=O)(c1ccccc1)c1ccccc1)c1ccc(N(Cc2ccccc2)Cc2ccccc2)cc1.
What is the InChIKey of CID 139733633?
The InChIKey is BYSBCQRLDZBGRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H30NO2S.C6BF8/c36-34(27-38(37,32-17-9-3-10-18-32)33-19-11-4-12-20-33)30-21-23-31(24-22-30)35(25-28-13-5-1-6-14-28)26-29-15-7-2-8-16-29;8-2-1(7(13,14)15)3(9)5(11)6(12)4(2)10/h1-24H,25-27H2;/q+1;-1.
What are the key properties of CID 139733633?
CID 139733633 has a molecular weight of 751.55 g/mol, XLogP of 10.13, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139733633 is sourced from PubChem (CID 139733633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).