C28H32N2O5 — CID 139733921
1-amino-2-[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]-4-methylidenecyclopentane-1-carboxylic acid (PubChem CID 139733921) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is 1-amino-2-[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]-4-methylidenecyclopentane-1-carboxylic acid.
| Compound Name | 1-amino-2-[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]-4-methylidenecyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 139733921 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 1-amino-2-[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]-4-methylidenecyclopentane-1-carboxylic acid |
| SMILES | C=C1CC(C(=O)[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)[C@@H](C)CC)C(N)(C(=O)O)C1 |
| InChI | InChI=1S/C28H32N2O5/c1-4-17(3)24(25(31)23-13-16(2)14-28(23,29)26(32)33)30-27(34)35-15-22-20-11-7-5-9-18(20)19-10-6-8-12-21(19)22/h5-12,17,22-24H,2,4,13-15,29H2,1,3H3,(H,30,34)(H,32,33)/t17-,23?,24-,28?/m0/s1 |
| InChIKey | KKCVQHYIAMZTML-IBHNFKCISA-N |
| XLogP | 4.26 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|