C44H34BF20OP — CID 139734947
tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tritert-butyl(phenacyl)phosphanium (PubChem CID 139734947) has the molecular formula C44H34BF20OP and a molecular weight of 1000.50 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tritert-butyl(phenacyl)phosphanium.
| Compound Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tritert-butyl(phenacyl)phosphanium |
|---|---|
| PubChem CID | 139734947 |
| Molecular Formula | C44H34BF20OP |
| Molecular Weight | 1000.50 g/mol |
| Exact Mass | 1000.21 |
| IUPAC Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tritert-butyl(phenacyl)phosphanium |
| SMILES | CC(C)(C)[P+](CC(=O)c1ccccc1)(C(C)(C)C)C(C)(C)C.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C20H34OP/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-18(2,3)22(19(4,5)6,20(7,8)9)15-17(21)16-13-11-10-12-14-16/h;10-14H,15H2,1-9H3/q-1;+1 |
| InChIKey | BRKMHACZXZNRRE-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.50 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|