C50H21BF20NO3P — CID 139734636
[2-(3-nitrophenyl)-2-oxoethyl]-triphenylphosphanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139734636) has the molecular formula C50H21BF20NO3P and a molecular weight of 1105.47 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl]-triphenylphosphanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl]-triphenylphosphanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139734636 |
| Molecular Formula | C50H21BF20NO3P |
| Molecular Weight | 1105.47 g/mol |
| Exact Mass | 1105.10 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl]-triphenylphosphanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H21NO3P.C24BF20/c28-26(21-11-10-12-22(19-21)27(29)30)20-31(23-13-4-1-5-14-23,24-15-6-2-7-16-24)25-17-8-3-9-18-25;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h1-19H,20H2;/q+1;-1 |
| InChIKey | WMZYOZBBOQZYKB-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1105.47 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|