C15H7F4NO5S — CID 2800836
2,3,5,6-tetrafluoro-4-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylbenzoic acid (PubChem CID 2800836) has the molecular formula C15H7F4NO5S and a molecular weight of 389.28 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylbenzoic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 2800836 |
| Molecular Formula | C15H7F4NO5S |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylbenzoic acid |
| SMILES | O=C(CSc1c(F)c(F)c(C(=O)O)c(F)c1F)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H7F4NO5S/c16-10-9(15(22)23)11(17)13(19)14(12(10)18)26-5-8(21)6-2-1-3-7(4-6)20(24)25/h1-4H,5H2,(H,22,23) |
| InChIKey | LVYGONAUOFBCRI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|